C13H14F2N2O2 — CID 168997020
5-(difluoromethoxy)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 168997020) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 5-(difluoromethoxy)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 5-(difluoromethoxy)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 168997020 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-(difluoromethoxy)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C1Nc2ccc(OC(F)F)cc2C12CCNCC2 |
| InChI | InChI=1S/C13H14F2N2O2/c14-12(15)19-8-1-2-10-9(7-8)13(11(18)17-10)3-5-16-6-4-13/h1-2,7,12,16H,3-6H2,(H,17,18) |
| InChIKey | BFVJFHPJOQGKOD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |