C24H22Cl2FN5O2 — CID 50940375
5-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 50940375) has the molecular formula C24H22Cl2FN5O2 and a molecular weight of 502.38 g/mol. Its IUPAC name is 5-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 5-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 50940375 |
| Molecular Formula | C24H22Cl2FN5O2 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 5-[5-amino-6-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | C[C@@H](Oc1nc(-c2ccc3c(c2)C2(CCNCC2)C(=O)N3)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H22Cl2FN5O2/c1-12(19-15(25)3-4-16(27)20(19)26)34-22-21(28)30-11-18(31-22)13-2-5-17-14(10-13)24(23(33)32-17)6-8-29-9-7-24/h2-5,10-12,29H,6-9H2,1H3,(H2,28,30)(H,32,33)/t12-/m1/s1 |
| InChIKey | NJUIFESEGPSSEN-GFCCVEGCSA-N |
| XLogP | 4.89 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|