C18H15Cl2FN4O — CID 69460004
5-(4-aminophenyl)-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-amine (PubChem CID 69460004) has the molecular formula C18H15Cl2FN4O and a molecular weight of 393.25 g/mol. Its IUPAC name is 5-(4-aminophenyl)-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-amine.
| Compound Name | 5-(4-aminophenyl)-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-amine |
|---|---|
| PubChem CID | 69460004 |
| Molecular Formula | C18H15Cl2FN4O |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-(4-aminophenyl)-3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-amine |
| SMILES | CC(Oc1nc(-c2ccc(N)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H15Cl2FN4O/c1-9(15-12(19)6-7-13(21)16(15)20)26-18-17(23)24-8-14(25-18)10-2-4-11(22)5-3-10/h2-9H,22H2,1H3,(H2,23,24) |
| InChIKey | BLEIGEDAVXUBEA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|