C18H14Cl2FN3O — CID 141136428
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-phenylpyrazin-2-amine (PubChem CID 141136428) has the molecular formula C18H14Cl2FN3O and a molecular weight of 378.23 g/mol. Its IUPAC name is 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-phenylpyrazin-2-amine.
| Compound Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 141136428 |
| Molecular Formula | C18H14Cl2FN3O |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-phenylpyrazin-2-amine |
| SMILES | C[C@@H](Oc1nc(-c2ccccc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H14Cl2FN3O/c1-10(15-12(19)7-8-13(21)16(15)20)25-18-17(22)23-9-14(24-18)11-5-3-2-4-6-11/h2-10H,1H3,(H2,22,23)/t10-/m1/s1 |
| InChIKey | OWVWQJRWFDQJMZ-SNVBAGLBSA-N |
| XLogP | 5.31 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|