C17H12ClF2N3O — CID 141099252
3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-phenylpyrazin-2-amine (PubChem CID 141099252) has the molecular formula C17H12ClF2N3O and a molecular weight of 347.75 g/mol. Its IUPAC name is 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-phenylpyrazin-2-amine.
| Compound Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 141099252 |
| Molecular Formula | C17H12ClF2N3O |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-phenylpyrazin-2-amine |
| SMILES | Nc1ncc(-c2ccccc2)nc1OCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C17H12ClF2N3O/c18-15-11(12(19)6-7-13(15)20)9-24-17-16(21)22-8-14(23-17)10-4-2-1-3-5-10/h1-8H,9H2,(H2,21,22) |
| InChIKey | VGKJPAFAZABIEO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|