C19H18Cl2FN5O3 — CID 91259558
2-[4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]pyrazol-1-yl]-2-methylpropanoic acid (PubChem CID 91259558) has the molecular formula C19H18Cl2FN5O3 and a molecular weight of 454.29 g/mol. Its IUPAC name is 2-[4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]pyrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]pyrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 91259558 |
| Molecular Formula | C19H18Cl2FN5O3 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-[4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]pyrazol-1-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(-c2cnc(N)c(OCCc3c(Cl)ccc(F)c3Cl)n2)cn1 |
| InChI | InChI=1S/C19H18Cl2FN5O3/c1-19(2,18(28)29)27-9-10(7-25-27)14-8-24-16(23)17(26-14)30-6-5-11-12(20)3-4-13(22)15(11)21/h3-4,7-9H,5-6H2,1-2H3,(H2,23,24)(H,28,29) |
| InChIKey | BVTBJFBURJFDNT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|