C23H22Cl2FN5O2 — CID 91190447
[4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone (PubChem CID 91190447) has the molecular formula C23H22Cl2FN5O2 and a molecular weight of 490.37 g/mol. Its IUPAC name is [4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 91190447 |
| Molecular Formula | C23H22Cl2FN5O2 |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | [4-[5-amino-6-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-piperazin-1-ylmethanone |
| SMILES | Nc1ncc(-c2ccc(C(=O)N3CCNCC3)cc2)nc1OCCc1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H22Cl2FN5O2/c24-17-5-6-18(26)20(25)16(17)7-12-33-22-21(27)29-13-19(30-22)14-1-3-15(4-2-14)23(32)31-10-8-28-9-11-31/h1-6,13,28H,7-12H2,(H2,27,29) |
| InChIKey | VWQIYBXAJKPUCL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|