C22H20ClF2N5O2 — CID 58886205
[3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone (PubChem CID 58886205) has the molecular formula C22H20ClF2N5O2 and a molecular weight of 459.88 g/mol. Its IUPAC name is [3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone.
| Compound Name | [3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 58886205 |
| Molecular Formula | C22H20ClF2N5O2 |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-[(3S)-3-aminopyrrolidin-1-yl]methanone |
| SMILES | Nc1ncc(-c2cccc(C(=O)N3CC[C@H](N)C3)c2)nc1OCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C22H20ClF2N5O2/c23-19-15(16(24)4-5-17(19)25)11-32-21-20(27)28-9-18(29-21)12-2-1-3-13(8-12)22(31)30-7-6-14(26)10-30/h1-5,8-9,14H,6-7,10-11,26H2,(H2,27,28)/t14-/m0/s1 |
| InChIKey | OWUYMIXCSOOPMZ-AWEZNQCLSA-N |
| XLogP | 3.41 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|