C25H26ClF2N5O2 — CID 91424788
4-[5-amino-6-[2-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 91424788) has the molecular formula C25H26ClF2N5O2 and a molecular weight of 501.97 g/mol. Its IUPAC name is 4-[5-amino-6-[2-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[5-amino-6-[2-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 91424788 |
| Molecular Formula | C25H26ClF2N5O2 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 4-[5-amino-6-[2-(2-chloro-3,6-difluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(NC(=O)c2ccc(-c3cnc(N)c(OCCc4c(F)ccc(F)c4Cl)n3)cc2)CC1 |
| InChI | InChI=1S/C25H26ClF2N5O2/c1-33-11-8-17(9-12-33)31-24(34)16-4-2-15(3-5-16)21-14-30-23(29)25(32-21)35-13-10-18-19(27)6-7-20(28)22(18)26/h2-7,14,17H,8-13H2,1H3,(H2,29,30)(H,31,34) |
| InChIKey | UDPCGCMKTLJLHZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|