C23H24ClF2N5O4S — CID 58886192
N-[3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-2-morpholin-4-ylethanesulfonamide (PubChem CID 58886192) has the molecular formula C23H24ClF2N5O4S and a molecular weight of 539.99 g/mol. Its IUPAC name is N-[3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-2-morpholin-4-ylethanesulfonamide.
| Compound Name | N-[3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-2-morpholin-4-ylethanesulfonamide |
|---|---|
| PubChem CID | 58886192 |
| Molecular Formula | C23H24ClF2N5O4S |
| Molecular Weight | 539.99 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-[3-[5-amino-6-[(2-chloro-3,6-difluorophenyl)methoxy]pyrazin-2-yl]phenyl]-2-morpholin-4-ylethanesulfonamide |
| SMILES | Nc1ncc(-c2cccc(NS(=O)(=O)CCN3CCOCC3)c2)nc1OCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C23H24ClF2N5O4S/c24-21-17(18(25)4-5-19(21)26)14-35-23-22(27)28-13-20(29-23)15-2-1-3-16(12-15)30-36(32,33)11-8-31-6-9-34-10-7-31/h1-5,12-13,30H,6-11,14H2,(H2,27,28) |
| InChIKey | BJCHVXIFOQTLEN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.99 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|