C24H24ClF2N3O3 — CID 21111083
3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine (PubChem CID 21111083) has the molecular formula C24H24ClF2N3O3 and a molecular weight of 475.92 g/mol. Its IUPAC name is 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine.
| Compound Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 21111083 |
| Molecular Formula | C24H24ClF2N3O3 |
| Molecular Weight | 475.92 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[4-(2-morpholin-4-ylethoxy)phenyl]pyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(OCCN3CCOCC3)cc2)cc1OCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C24H24ClF2N3O3/c25-23-19(20(26)5-6-21(23)27)15-33-22-13-17(14-29-24(22)28)16-1-3-18(4-2-16)32-12-9-30-7-10-31-11-8-30/h1-6,13-14H,7-12,15H2,(H2,28,29) |
| InChIKey | PFRUCUSYCGTLRJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|