C23H23ClF2N4O — CID 174487797
3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyrazin-2-amine (PubChem CID 174487797) has the molecular formula C23H23ClF2N4O and a molecular weight of 444.91 g/mol. Its IUPAC name is 3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyrazin-2-amine.
| Compound Name | 3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 174487797 |
| Molecular Formula | C23H23ClF2N4O |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-[(1S)-1-(2-chloro-3,6-difluorophenyl)ethoxy]-5-[4-(pyrrolidin-1-ylmethyl)phenyl]pyrazin-2-amine |
| SMILES | C[C@H](Oc1nc(-c2ccc(CN3CCCC3)cc2)cnc1N)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C23H23ClF2N4O/c1-14(20-17(25)8-9-18(26)21(20)24)31-23-22(27)28-12-19(29-23)16-6-4-15(5-7-16)13-30-10-2-3-11-30/h4-9,12,14H,2-3,10-11,13H2,1H3,(H2,27,28)/t14-/m0/s1 |
| InChIKey | KCOOBCZMJSPVNJ-AWEZNQCLSA-N |
| XLogP | 5.39 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|