C26H29Cl2N5O2 — CID 21111178
4-[5-amino-6-[1-(2,6-dichlorophenyl)ethoxy]pyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 21111178) has the molecular formula C26H29Cl2N5O2 and a molecular weight of 514.46 g/mol. Its IUPAC name is 4-[5-amino-6-[1-(2,6-dichlorophenyl)ethoxy]pyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 4-[5-amino-6-[1-(2,6-dichlorophenyl)ethoxy]pyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 21111178 |
| Molecular Formula | C26H29Cl2N5O2 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 4-[5-amino-6-[1-(2,6-dichlorophenyl)ethoxy]pyrazin-2-yl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | CC(Oc1nc(-c2ccc(C(=O)NCCCN3CCCC3)cc2)cnc1N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H29Cl2N5O2/c1-17(23-20(27)6-4-7-21(23)28)35-26-24(29)31-16-22(32-26)18-8-10-19(11-9-18)25(34)30-12-5-15-33-13-2-3-14-33/h4,6-11,16-17H,2-3,5,12-15H2,1H3,(H2,29,31)(H,30,34) |
| InChIKey | DYCFNCARNPWXNS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|