C23H33N7O3S — CID 10345359
3-amino-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazine-2-carboxamide (PubChem CID 10345359) has the molecular formula C23H33N7O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 3-amino-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10345359 |
| Molecular Formula | C23H33N7O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 3-amino-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(4-pyrrolidin-1-ylsulfonylphenyl)pyrazine-2-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2nc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)cnc2N)CC1 |
| InChI | InChI=1S/C23H33N7O3S/c1-28-13-15-29(16-14-28)10-4-9-25-23(31)21-22(24)26-17-20(27-21)18-5-7-19(8-6-18)34(32,33)30-11-2-3-12-30/h5-8,17H,2-4,9-16H2,1H3,(H2,24,26)(H,25,31) |
| InChIKey | SPPMIPVBWLFKGR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|