C18H23Cl2N7O3S — CID 87503599
3-amino-N-(cyanomethyl)-6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrazine-2-carboxamide;dihydrochloride (PubChem CID 87503599) has the molecular formula C18H23Cl2N7O3S and a molecular weight of 488.40 g/mol. Its IUPAC name is 3-amino-N-(cyanomethyl)-6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrazine-2-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(cyanomethyl)-6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 87503599 |
| Molecular Formula | C18H23Cl2N7O3S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 3-amino-N-(cyanomethyl)-6-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrazine-2-carboxamide;dihydrochloride |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(-c3cnc(N)c(C(=O)NCC#N)n3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H21N7O3S.2ClH/c1-24-8-10-25(11-9-24)29(27,28)14-4-2-13(3-5-14)15-12-22-17(20)16(23-15)18(26)21-7-6-19;;/h2-5,12H,7-11H2,1H3,(H2,20,22)(H,21,26);2*1H |
| InChIKey | JUDGVYFKBFTBME-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|