C22H18FNO3 — CID 14616665
5-fluoro-3,3-bis(2-hydroxy-4-methylphenyl)-1H-indol-2-one (PubChem CID 14616665) has the molecular formula C22H18FNO3 and a molecular weight of 363.39 g/mol. Its IUPAC name is 5-fluoro-3,3-bis(2-hydroxy-4-methylphenyl)-1H-indol-2-one.
| Compound Name | 5-fluoro-3,3-bis(2-hydroxy-4-methylphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 14616665 |
| Molecular Formula | C22H18FNO3 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-fluoro-3,3-bis(2-hydroxy-4-methylphenyl)-1H-indol-2-one |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3O)C(=O)Nc3ccc(F)cc32)c(O)c1 |
| InChI | InChI=1S/C22H18FNO3/c1-12-3-6-15(19(25)9-12)22(16-7-4-13(2)10-20(16)26)17-11-14(23)5-8-18(17)24-21(22)27/h3-11,25-26H,1-2H3,(H,24,27) |
| InChIKey | TXUILVWJPIXQJV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |