C22H16FNO2 — CID 14616674
6-fluoro-3',6'-dimethylspiro[1H-indole-3,9'-xanthene]-2-one (PubChem CID 14616674) has the molecular formula C22H16FNO2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 6-fluoro-3',6'-dimethylspiro[1H-indole-3,9'-xanthene]-2-one.
| Compound Name | 6-fluoro-3',6'-dimethylspiro[1H-indole-3,9'-xanthene]-2-one |
|---|---|
| PubChem CID | 14616674 |
| Molecular Formula | C22H16FNO2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 6-fluoro-3',6'-dimethylspiro[1H-indole-3,9'-xanthene]-2-one |
| SMILES | Cc1ccc2c(c1)Oc1cc(C)ccc1C21C(=O)Nc2cc(F)ccc21 |
| InChI | InChI=1S/C22H16FNO2/c1-12-3-6-16-19(9-12)26-20-10-13(2)4-7-17(20)22(16)15-8-5-14(23)11-18(15)24-21(22)25/h3-11H,1-2H3,(H,24,25) |
| InChIKey | MCIHWAGCJOJIBD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |