C18H14N4O5 — CID 7348383
(2S)-3-acetyl-5-[(4-nitrophenyl)methyl]spiro[1,3,4-oxadiazole-2,3'-1H-indole]-2'-one (PubChem CID 7348383) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is (2S)-3-acetyl-5-[(4-nitrophenyl)methyl]spiro[1,3,4-oxadiazole-2,3'-1H-indole]-2'-one.
| Compound Name | (2S)-3-acetyl-5-[(4-nitrophenyl)methyl]spiro[1,3,4-oxadiazole-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 7348383 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2S)-3-acetyl-5-[(4-nitrophenyl)methyl]spiro[1,3,4-oxadiazole-2,3'-1H-indole]-2'-one |
| SMILES | CC(=O)N1N=C(Cc2ccc([N+](=O)[O-])cc2)O[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H14N4O5/c1-11(23)21-18(14-4-2-3-5-15(14)19-17(18)24)27-16(20-21)10-12-6-8-13(9-7-12)22(25)26/h2-9H,10H2,1H3,(H,19,24)/t18-/m0/s1 |
| InChIKey | HLXKYHYUVIUJEK-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|