C28H19BrN4O3 — CID 136961456
1'-benzyl-5'-bromo-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione (PubChem CID 136961456) has the molecular formula C28H19BrN4O3 and a molecular weight of 539.39 g/mol. Its IUPAC name is 1'-benzyl-5'-bromo-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione.
| Compound Name | 1'-benzyl-5'-bromo-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione |
|---|---|
| PubChem CID | 136961456 |
| Molecular Formula | C28H19BrN4O3 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 1'-benzyl-5'-bromo-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione |
| SMILES | O=C1OCC2=C1C1(C(=O)N(Cc3ccccc3)c3ccc(Br)cc31)c1c(n[nH]c1-c1ccccc1)N2 |
| InChI | InChI=1S/C28H19BrN4O3/c29-18-11-12-21-19(13-18)28(27(35)33(21)14-16-7-3-1-4-8-16)22-20(15-36-26(22)34)30-25-23(28)24(31-32-25)17-9-5-2-6-10-17/h1-13H,14-15H2,(H2,30,31,32) |
| InChIKey | FGECRRJNAWXVJP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |