C29H22N4O4 — CID 136961457
1'-benzyl-5'-methoxy-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione (PubChem CID 136961457) has the molecular formula C29H22N4O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is 1'-benzyl-5'-methoxy-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione.
| Compound Name | 1'-benzyl-5'-methoxy-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione |
|---|---|
| PubChem CID | 136961457 |
| Molecular Formula | C29H22N4O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 1'-benzyl-5'-methoxy-6-phenylspiro[11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-triene-8,3'-indole]-2',10-dione |
| SMILES | COc1ccc2c(c1)C1(C(=O)N2Cc2ccccc2)C2=C(COC2=O)Nc2n[nH]c(-c3ccccc3)c21 |
| InChI | InChI=1S/C29H22N4O4/c1-36-19-12-13-22-20(14-19)29(28(35)33(22)15-17-8-4-2-5-9-17)23-21(16-37-27(23)34)30-26-24(29)25(31-32-26)18-10-6-3-7-11-18/h2-14H,15-16H2,1H3,(H2,30,31,32) |
| InChIKey | KQXNOLFOEGSOOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |