C25H23NO3 — CID 11014506
3-acetyl-1,3-dibenzyl-5-methoxyindol-2-one (PubChem CID 11014506) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-acetyl-1,3-dibenzyl-5-methoxyindol-2-one.
| Compound Name | 3-acetyl-1,3-dibenzyl-5-methoxyindol-2-one |
|---|---|
| PubChem CID | 11014506 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 3-acetyl-1,3-dibenzyl-5-methoxyindol-2-one |
| SMILES | COc1ccc2c(c1)C(Cc1ccccc1)(C(C)=O)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-18(27)25(16-19-9-5-3-6-10-19)22-15-21(29-2)13-14-23(22)26(24(25)28)17-20-11-7-4-8-12-20/h3-15H,16-17H2,1-2H3 |
| InChIKey | ZVQJXMZXUGPXRA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|