C29H27NO5 — CID 102487576
ethyl 2-benzyl-4-(1-benzyl-3-hydroxy-5-methoxy-2-oxoindol-3-yl)buta-2,3-dienoate (PubChem CID 102487576) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 2-benzyl-4-(1-benzyl-3-hydroxy-5-methoxy-2-oxoindol-3-yl)buta-2,3-dienoate.
| Compound Name | ethyl 2-benzyl-4-(1-benzyl-3-hydroxy-5-methoxy-2-oxoindol-3-yl)buta-2,3-dienoate |
|---|---|
| PubChem CID | 102487576 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | ethyl 2-benzyl-4-(1-benzyl-3-hydroxy-5-methoxy-2-oxoindol-3-yl)buta-2,3-dienoate |
| SMILES | CCOC(=O)C(=C=CC1(O)C(=O)N(Cc2ccccc2)c2ccc(OC)cc21)Cc1ccccc1 |
| InChI | InChI=1S/C29H27NO5/c1-3-35-27(31)23(18-21-10-6-4-7-11-21)16-17-29(33)25-19-24(34-2)14-15-26(25)30(28(29)32)20-22-12-8-5-9-13-22/h4-15,17,19,33H,3,18,20H2,1-2H3 |
| InChIKey | ISEBCFAHTZWVCX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|