C30H33NO6 — CID 177395321
diethyl 4-[(E)-2-(1-benzyl-3-hydroxy-5-methyl-2-oxoindol-3-yl)ethenyl]cyclohexene-1,4-dicarboxylate (PubChem CID 177395321) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is diethyl 4-[(E)-2-(1-benzyl-3-hydroxy-5-methyl-2-oxoindol-3-yl)ethenyl]cyclohexene-1,4-dicarboxylate.
| Compound Name | diethyl 4-[(E)-2-(1-benzyl-3-hydroxy-5-methyl-2-oxoindol-3-yl)ethenyl]cyclohexene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 177395321 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | diethyl 4-[(E)-2-(1-benzyl-3-hydroxy-5-methyl-2-oxoindol-3-yl)ethenyl]cyclohexene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=CCC(/C=C/C2(O)C(=O)N(Cc3ccccc3)c3ccc(C)cc32)(C(=O)OCC)CC1 |
| InChI | InChI=1S/C30H33NO6/c1-4-36-26(32)23-13-15-29(16-14-23,28(34)37-5-2)17-18-30(35)24-19-21(3)11-12-25(24)31(27(30)33)20-22-9-7-6-8-10-22/h6-13,17-19,35H,4-5,14-16,20H2,1-3H3/b18-17+ |
| InChIKey | XAJHVFQUQZGHRG-ISLYRVAYSA-N |
| XLogP | 4.51 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|