C27H15N3O4 — CID 122227207
13-phenylspiro[17-oxa-14,15-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12,15-hexaene-11,3'-1H-indole]-2',8,9-trione (PubChem CID 122227207) has the molecular formula C27H15N3O4 and a molecular weight of 445.43 g/mol. Its IUPAC name is 13-phenylspiro[17-oxa-14,15-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12,15-hexaene-11,3'-1H-indole]-2',8,9-trione.
| Compound Name | 13-phenylspiro[17-oxa-14,15-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12,15-hexaene-11,3'-1H-indole]-2',8,9-trione |
|---|---|
| PubChem CID | 122227207 |
| Molecular Formula | C27H15N3O4 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 13-phenylspiro[17-oxa-14,15-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,12,15-hexaene-11,3'-1H-indole]-2',8,9-trione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1C1(C(=O)Nc3ccccc31)c1c(n[nH]c1-c1ccccc1)O2 |
| InChI | InChI=1S/C27H15N3O4/c31-22-15-10-4-5-11-16(15)24-20(23(22)32)27(17-12-6-7-13-18(17)28-26(27)33)19-21(29-30-25(19)34-24)14-8-2-1-3-9-14/h1-13H,(H,28,33)(H,29,30) |
| InChIKey | HZEHWYLXFRPYRA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|