C21H19N3O4 — CID 46901853
2',8',8'-trimethylspiro[1H-indole-3,5'-7,9-dihydro-3H-chromeno[2,3-d]pyrimidine]-2,4',6'-trione (PubChem CID 46901853) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2',8',8'-trimethylspiro[1H-indole-3,5'-7,9-dihydro-3H-chromeno[2,3-d]pyrimidine]-2,4',6'-trione.
| Compound Name | 2',8',8'-trimethylspiro[1H-indole-3,5'-7,9-dihydro-3H-chromeno[2,3-d]pyrimidine]-2,4',6'-trione |
|---|---|
| PubChem CID | 46901853 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2',8',8'-trimethylspiro[1H-indole-3,5'-7,9-dihydro-3H-chromeno[2,3-d]pyrimidine]-2,4',6'-trione |
| SMILES | Cc1nc2c(c(=O)[nH]1)C1(C(=O)Nc3ccccc31)C1=C(CC(C)(C)CC1=O)O2 |
| InChI | InChI=1S/C21H19N3O4/c1-10-22-17(26)16-18(23-10)28-14-9-20(2,3)8-13(25)15(14)21(16)11-6-4-5-7-12(11)24-19(21)27/h4-7H,8-9H2,1-3H3,(H,24,27)(H,22,23,26) |
| InChIKey | VTIJVZQNLQSLHP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |