C26H22N2O3 — CID 122387230
3,7,7-trimethylspiro[6,8-dihydro-2H-chromeno[2,3-c]pyrazole-4,10'-phenanthrene]-5,9'-dione (PubChem CID 122387230) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3,7,7-trimethylspiro[6,8-dihydro-2H-chromeno[2,3-c]pyrazole-4,10'-phenanthrene]-5,9'-dione.
| Compound Name | 3,7,7-trimethylspiro[6,8-dihydro-2H-chromeno[2,3-c]pyrazole-4,10'-phenanthrene]-5,9'-dione |
|---|---|
| PubChem CID | 122387230 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 3,7,7-trimethylspiro[6,8-dihydro-2H-chromeno[2,3-c]pyrazole-4,10'-phenanthrene]-5,9'-dione |
| SMILES | Cc1[nH]nc2c1C1(C(=O)c3ccccc3-c3ccccc31)C1=C(CC(C)(C)CC1=O)O2 |
| InChI | InChI=1S/C26H22N2O3/c1-14-21-24(28-27-14)31-20-13-25(2,3)12-19(29)22(20)26(21)18-11-7-6-9-16(18)15-8-4-5-10-17(15)23(26)30/h4-11H,12-13H2,1-3H3,(H,27,28) |
| InChIKey | NRWBGJDSGKTJJB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |