About 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile
6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile (PubChem CID 12924203) has the molecular formula C20H14N4O
and a molecular weight of 326.36 g/mol. Its IUPAC name is 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile |
| PubChem CID | 12924203 |
| Molecular Formula | C20H14N4O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile |
| SMILES | Cc1[nH]nc2c1C1(C(C#N)=C(N)O2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H14N4O/c1-11-17-19(24-23-11)25-18(22)16(10-21)20(17)14-8-4-2-6-12(14)13-7-3-5-9-15(13)20/h2-9H,22H2,1H3,(H,23,24) |
| InChIKey | DWYREZQPJRBHLO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile?
The IUPAC name of 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile (CID 12924203) is 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile.
What is the SMILES notation for 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile?
The canonical SMILES for 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile is Cc1[nH]nc2c1C1(C(C#N)=C(N)O2)c2ccccc2-c2ccccc21.
What is the InChIKey of 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile?
The InChIKey is DWYREZQPJRBHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O/c1-11-17-19(24-23-11)25-18(22)16(10-21)20(17)14-8-4-2-6-12(14)13-7-3-5-9-15(13)20/h2-9H,22H2,1H3,(H,23,24).
What are the key properties of 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile?
6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile has a molecular weight of 326.36 g/mol, XLogP of 3.12, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methylspiro[2H-pyrano[2,3-c]pyrazole-4,9'-fluorene]-5-carbonitrile is sourced from PubChem (CID 12924203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).