C22H19NO3 — CID 54065813
3,3-bis(2-hydroxy-3-methylphenyl)-1H-indol-2-one (PubChem CID 54065813) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3,3-bis(2-hydroxy-3-methylphenyl)-1H-indol-2-one.
| Compound Name | 3,3-bis(2-hydroxy-3-methylphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 54065813 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 3,3-bis(2-hydroxy-3-methylphenyl)-1H-indol-2-one |
| SMILES | Cc1cccc(C2(c3cccc(C)c3O)C(=O)Nc3ccccc32)c1O |
| InChI | InChI=1S/C22H19NO3/c1-13-7-5-10-16(19(13)24)22(17-11-6-8-14(2)20(17)25)15-9-3-4-12-18(15)23-21(22)26/h3-12,24-25H,1-2H3,(H,23,26) |
| InChIKey | MCWLLIDJPWDKLO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |