C21H17NO2 — CID 11558717
3-(4-hydroxy-3-methylphenyl)-3-phenyl-1H-indol-2-one (PubChem CID 11558717) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methylphenyl)-3-phenyl-1H-indol-2-one.
| Compound Name | 3-(4-hydroxy-3-methylphenyl)-3-phenyl-1H-indol-2-one |
|---|---|
| PubChem CID | 11558717 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-(4-hydroxy-3-methylphenyl)-3-phenyl-1H-indol-2-one |
| SMILES | Cc1cc(C2(c3ccccc3)C(=O)Nc3ccccc32)ccc1O |
| InChI | InChI=1S/C21H17NO2/c1-14-13-16(11-12-19(14)23)21(15-7-3-2-4-8-15)17-9-5-6-10-18(17)22-20(21)24/h2-13,23H,1H3,(H,22,24) |
| InChIKey | NPTGGFIUJLVTAW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |