C22H17NO3 — CID 132600722
1'-hydroxy-3'-methoxy-2'-methylspiro[1H-indole-3,9'-fluorene]-2-one (PubChem CID 132600722) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1'-hydroxy-3'-methoxy-2'-methylspiro[1H-indole-3,9'-fluorene]-2-one.
| Compound Name | 1'-hydroxy-3'-methoxy-2'-methylspiro[1H-indole-3,9'-fluorene]-2-one |
|---|---|
| PubChem CID | 132600722 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1'-hydroxy-3'-methoxy-2'-methylspiro[1H-indole-3,9'-fluorene]-2-one |
| SMILES | COc1cc2c(c(O)c1C)C1(C(=O)Nc3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C22H17NO3/c1-12-18(26-2)11-14-13-7-3-4-8-15(13)22(19(14)20(12)24)16-9-5-6-10-17(16)23-21(22)25/h3-11,24H,1-2H3,(H,23,25) |
| InChIKey | FQQVKODNRVDRQI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |