C18H17BrN6O3 — CID 102257396
6'-amino-5-bromo-3',3'-dimethyl-9'-nitro-2-oxospiro[1H-indole-3,8'-2,4-dihydro-1H-pyrido[1,2-a]pyrimidine]-7'-carbonitrile (PubChem CID 102257396) has the molecular formula C18H17BrN6O3 and a molecular weight of 445.28 g/mol. Its IUPAC name is 6'-amino-5-bromo-3',3'-dimethyl-9'-nitro-2-oxospiro[1H-indole-3,8'-2,4-dihydro-1H-pyrido[1,2-a]pyrimidine]-7'-carbonitrile.
| Compound Name | 6'-amino-5-bromo-3',3'-dimethyl-9'-nitro-2-oxospiro[1H-indole-3,8'-2,4-dihydro-1H-pyrido[1,2-a]pyrimidine]-7'-carbonitrile |
|---|---|
| PubChem CID | 102257396 |
| Molecular Formula | C18H17BrN6O3 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 6'-amino-5-bromo-3',3'-dimethyl-9'-nitro-2-oxospiro[1H-indole-3,8'-2,4-dihydro-1H-pyrido[1,2-a]pyrimidine]-7'-carbonitrile |
| SMILES | CC1(C)CNC2=C([N+](=O)[O-])C3(C(=O)Nc4ccc(Br)cc43)C(C#N)=C(N)N2C1 |
| InChI | InChI=1S/C18H17BrN6O3/c1-17(2)7-22-15-13(25(27)28)18(11(6-20)14(21)24(15)8-17)10-5-9(19)3-4-12(10)23-16(18)26/h3-5,22H,7-8,21H2,1-2H3,(H,23,26) |
| InChIKey | ZMNFUEUFLDOOCK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|