C28H19N3O5 — CID 71544658
16-benzoyl-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione (PubChem CID 71544658) has the molecular formula C28H19N3O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is 16-benzoyl-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione.
| Compound Name | 16-benzoyl-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione |
|---|---|
| PubChem CID | 71544658 |
| Molecular Formula | C28H19N3O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 16-benzoyl-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione |
| SMILES | O=C(C1=C2NCCN2C2=C(C(=O)c3ccccc3C2=O)C1c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C28H19N3O5/c32-25(17-6-2-1-3-7-17)23-21(16-10-12-18(13-11-16)31(35)36)22-24(30-15-14-29-28(23)30)27(34)20-9-5-4-8-19(20)26(22)33/h1-13,21,29H,14-15H2 |
| InChIKey | WQVLZMONGFLOFB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|