C25H15NO6 — CID 18785316
2-(4-methylbenzoyl)-3-(4-nitrobenzoyl)naphthalene-1,4-dione (PubChem CID 18785316) has the molecular formula C25H15NO6 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-(4-methylbenzoyl)-3-(4-nitrobenzoyl)naphthalene-1,4-dione.
| Compound Name | 2-(4-methylbenzoyl)-3-(4-nitrobenzoyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 18785316 |
| Molecular Formula | C25H15NO6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-(4-methylbenzoyl)-3-(4-nitrobenzoyl)naphthalene-1,4-dione |
| SMILES | Cc1ccc(C(=O)C2=C(C(=O)c3ccc([N+](=O)[O-])cc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H15NO6/c1-14-6-8-15(9-7-14)22(27)20-21(23(28)16-10-12-17(13-11-16)26(31)32)25(30)19-5-3-2-4-18(19)24(20)29/h2-13H,1H3 |
| InChIKey | QGMLWOXMYRPCKA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 111.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|