C21H14N4O6 — CID 132850693
16-nitro-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione (PubChem CID 132850693) has the molecular formula C21H14N4O6 and a molecular weight of 418.37 g/mol. Its IUPAC name is 16-nitro-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione.
| Compound Name | 16-nitro-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione |
|---|---|
| PubChem CID | 132850693 |
| Molecular Formula | C21H14N4O6 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 16-nitro-17-(4-nitrophenyl)-11,14-diazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7,15-pentaene-2,9-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)N1CCNC1=C([N+](=O)[O-])C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14N4O6/c26-19-13-3-1-2-4-14(13)20(27)17-16(19)15(11-5-7-12(8-6-11)24(28)29)18(25(30)31)21-22-9-10-23(17)21/h1-8,15,22H,9-10H2 |
| InChIKey | PAGJJCOGLCJMMQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|