C25H24N4O2 — CID 98588228
(3S,3'R)-2'-imino-1'-[(4-methoxyphenyl)methyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile (PubChem CID 98588228) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3S,3'R)-2'-imino-1'-[(4-methoxyphenyl)methyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile.
| Compound Name | (3S,3'R)-2'-imino-1'-[(4-methoxyphenyl)methyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile |
|---|---|
| PubChem CID | 98588228 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3S,3'R)-2'-imino-1'-[(4-methoxyphenyl)methyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)[C@]2(C(=O)Nc3ccccc32)C2=C(CCCC2)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-31-17-12-10-16(11-13-17)15-29-22-9-5-3-7-19(22)25(20(14-26)23(29)27)18-6-2-4-8-21(18)28-24(25)30/h2,4,6,8,10-13,20,27H,3,5,7,9,15H2,1H3,(H,28,30)/b27-23+/t20-,25-/m1/s1 |
| InChIKey | UETHKOOPLSSYMI-PIANUSPTSA-N |
| XLogP | 4.35 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|