C16H16N2O4 — CID 70055125
3,4-dihydroxy-1-[(4-methoxyphenyl)methyl]-3H-quinoxalin-2-one (PubChem CID 70055125) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3,4-dihydroxy-1-[(4-methoxyphenyl)methyl]-3H-quinoxalin-2-one.
| Compound Name | 3,4-dihydroxy-1-[(4-methoxyphenyl)methyl]-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 70055125 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3,4-dihydroxy-1-[(4-methoxyphenyl)methyl]-3H-quinoxalin-2-one |
| SMILES | COc1ccc(CN2C(=O)C(O)N(O)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-22-12-8-6-11(7-9-12)10-17-13-4-2-3-5-14(13)18(21)16(20)15(17)19/h2-9,16,20-21H,10H2,1H3 |
| InChIKey | IRIDWMNWLFRYMM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |