C18H18N2O3S — CID 73321398
5-[(4-hydroxyphenyl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 73321398) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-[(4-hydroxyphenyl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(4-hydroxyphenyl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 73321398 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 5-[(4-hydroxyphenyl)methyl]-3-[(4-methoxyphenyl)methyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)C(Cc3ccc(O)cc3)NC2=S)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-23-15-8-4-13(5-9-15)11-20-17(22)16(19-18(20)24)10-12-2-6-14(21)7-3-12/h2-9,16,21H,10-11H2,1H3,(H,19,24) |
| InChIKey | TZALZJBNUUTQIL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|