C26H26N4O2 — CID 98882099
(3R,3'S)-2'-imino-1'-[2-(4-methoxyphenyl)ethyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile (PubChem CID 98882099) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (3R,3'S)-2'-imino-1'-[2-(4-methoxyphenyl)ethyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile.
| Compound Name | (3R,3'S)-2'-imino-1'-[2-(4-methoxyphenyl)ethyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile |
|---|---|
| PubChem CID | 98882099 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (3R,3'S)-2'-imino-1'-[2-(4-methoxyphenyl)ethyl]-2-oxospiro[1H-indole-3,4'-5,6,7,8-tetrahydro-3H-quinoline]-3'-carbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)[C@@]2(C(=O)Nc3ccccc32)C2=C(CCCC2)N1CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-32-18-12-10-17(11-13-18)14-15-30-23-9-5-3-7-20(23)26(21(16-27)24(30)28)19-6-2-4-8-22(19)29-25(26)31/h2,4,6,8,10-13,21,28H,3,5,7,9,14-15H2,1H3,(H,29,31)/b28-24+/t21-,26-/m0/s1 |
| InChIKey | ZLGBBTWJNVRPHZ-AVPIEEAHSA-N |
| XLogP | 4.39 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|