C22H17N5OS — CID 7236585
(3R,4S)-6-amino-2-imino-2'-oxo-1'-(2-phenylethyl)spiro[3H-thiopyran-4,3'-indole]-3,5-dicarbonitrile (PubChem CID 7236585) has the molecular formula C22H17N5OS and a molecular weight of 399.48 g/mol. Its IUPAC name is (3R,4S)-6-amino-2-imino-2'-oxo-1'-(2-phenylethyl)spiro[3H-thiopyran-4,3'-indole]-3,5-dicarbonitrile.
| Compound Name | (3R,4S)-6-amino-2-imino-2'-oxo-1'-(2-phenylethyl)spiro[3H-thiopyran-4,3'-indole]-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 7236585 |
| Molecular Formula | C22H17N5OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (3R,4S)-6-amino-2-imino-2'-oxo-1'-(2-phenylethyl)spiro[3H-thiopyran-4,3'-indole]-3,5-dicarbonitrile |
| SMILES | [H]/N=C1\SC(N)=C(C#N)[C@]2(C(=O)N(CCc3ccccc3)c3ccccc32)[C@@H]1C#N |
| InChI | InChI=1S/C22H17N5OS/c23-12-16-19(25)29-20(26)17(13-24)22(16)15-8-4-5-9-18(15)27(21(22)28)11-10-14-6-2-1-3-7-14/h1-9,16,25H,10-11,26H2/b25-19-/t16-,22-/m1/s1 |
| InChIKey | QMCRPYFBNZOXIL-VARKBFDGSA-N |
| XLogP | 3.07 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|