C24H25N5O2 — CID 53447587
6-amino-1'-benzyl-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile (PubChem CID 53447587) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 6-amino-1'-benzyl-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile.
| Compound Name | 6-amino-1'-benzyl-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile |
|---|---|
| PubChem CID | 53447587 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 6-amino-1'-benzyl-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile |
| SMILES | CCCC1NNC2OC(N)=C(C#N)C3(C(=O)N(Cc4ccccc4)c4ccccc43)C12 |
| InChI | InChI=1S/C24H25N5O2/c1-2-8-18-20-22(28-27-18)31-21(26)17(13-25)24(20)16-11-6-7-12-19(16)29(23(24)30)14-15-9-4-3-5-10-15/h3-7,9-12,18,20,22,27-28H,2,8,14,26H2,1H3 |
| InChIKey | AUCMTHIAPJIQKI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |