C25H16Cl2N4O2 — CID 15366589
1'-(4-chlorophenyl)-6'-(4-chlorophenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile (PubChem CID 15366589) has the molecular formula C25H16Cl2N4O2 and a molecular weight of 475.34 g/mol. Its IUPAC name is 1'-(4-chlorophenyl)-6'-(4-chlorophenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile.
| Compound Name | 1'-(4-chlorophenyl)-6'-(4-chlorophenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile |
|---|---|
| PubChem CID | 15366589 |
| Molecular Formula | C25H16Cl2N4O2 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1'-(4-chlorophenyl)-6'-(4-chlorophenyl)imino-2,2'-dioxospiro[1H-indole-3,4'-piperidine]-3'-carbonitrile |
| SMILES | N#CC1C(=O)N(c2ccc(Cl)cc2)/C(=N/c2ccc(Cl)cc2)CC12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C25H16Cl2N4O2/c26-15-5-9-17(10-6-15)29-22-13-25(19-3-1-2-4-21(19)30-24(25)33)20(14-28)23(32)31(22)18-11-7-16(27)8-12-18/h1-12,20H,13H2,(H,30,33)/b29-22+ |
| InChIKey | TYDVYNROQLLCIP-QUPMIFSKSA-N |
| XLogP | 5.49 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|