C22H17ClN4O — CID 101474693
(3S,3'S,8'S)-3'-(4-chlorophenyl)-2-oxospiro[1H-indole-3,2'-5,6,7,8-tetrahydro-3H-pyrrolizine]-1',1'-dicarbonitrile (PubChem CID 101474693) has the molecular formula C22H17ClN4O and a molecular weight of 388.86 g/mol. Its IUPAC name is (3S,3'S,8'S)-3'-(4-chlorophenyl)-2-oxospiro[1H-indole-3,2'-5,6,7,8-tetrahydro-3H-pyrrolizine]-1',1'-dicarbonitrile.
| Compound Name | (3S,3'S,8'S)-3'-(4-chlorophenyl)-2-oxospiro[1H-indole-3,2'-5,6,7,8-tetrahydro-3H-pyrrolizine]-1',1'-dicarbonitrile |
|---|---|
| PubChem CID | 101474693 |
| Molecular Formula | C22H17ClN4O |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (3S,3'S,8'S)-3'-(4-chlorophenyl)-2-oxospiro[1H-indole-3,2'-5,6,7,8-tetrahydro-3H-pyrrolizine]-1',1'-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H]2CCCN2[C@@H](c2ccc(Cl)cc2)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H17ClN4O/c23-15-9-7-14(8-10-15)19-22(16-4-1-2-5-17(16)26-20(22)28)21(12-24,13-25)18-6-3-11-27(18)19/h1-2,4-5,7-10,18-19H,3,6,11H2,(H,26,28)/t18-,19-,22-/m0/s1 |
| InChIKey | GVFCVKJEBKJRLU-IPJJNNNSSA-N |
| XLogP | 3.78 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |