C22H18N4O — CID 135002693
(3S,3'R)-2-oxo-3'-phenylspiro[1H-indole-3,1'-5,6,7,8-tetrahydro-3H-pyrrolizine]-2',2'-dicarbonitrile (PubChem CID 135002693) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is (3S,3'R)-2-oxo-3'-phenylspiro[1H-indole-3,1'-5,6,7,8-tetrahydro-3H-pyrrolizine]-2',2'-dicarbonitrile.
| Compound Name | (3S,3'R)-2-oxo-3'-phenylspiro[1H-indole-3,1'-5,6,7,8-tetrahydro-3H-pyrrolizine]-2',2'-dicarbonitrile |
|---|---|
| PubChem CID | 135002693 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3S,3'R)-2-oxo-3'-phenylspiro[1H-indole-3,1'-5,6,7,8-tetrahydro-3H-pyrrolizine]-2',2'-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](c2ccccc2)N2CCCC2[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H18N4O/c23-13-21(14-24)19(15-7-2-1-3-8-15)26-12-6-11-18(26)22(21)16-9-4-5-10-17(16)25-20(22)27/h1-5,7-10,18-19H,6,11-12H2,(H,25,27)/t18?,19-,22+/m1/s1 |
| InChIKey | RSSMPWAEHLLCEE-MDKRWRRSSA-N |
| XLogP | 3.13 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |