C30H21N3O3 — CID 56964667
(2'S,3R,7'R)-2,4'-dioxo-2',7'-diphenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile (PubChem CID 56964667) has the molecular formula C30H21N3O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is (2'S,3R,7'R)-2,4'-dioxo-2',7'-diphenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile.
| Compound Name | (2'S,3R,7'R)-2,4'-dioxo-2',7'-diphenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile |
|---|---|
| PubChem CID | 56964667 |
| Molecular Formula | C30H21N3O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2'S,3R,7'R)-2,4'-dioxo-2',7'-diphenylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](c2ccccc2)CC2=C(C(=O)C[C@@H](c3ccccc3)O2)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H21N3O3/c31-17-29(18-32)22(19-9-3-1-4-10-19)15-26-27(24(34)16-25(36-26)20-11-5-2-6-12-20)30(29)21-13-7-8-14-23(21)33-28(30)35/h1-14,22,25H,15-16H2,(H,33,35)/t22-,25+,30-/m1/s1 |
| InChIKey | WTXPTXUMTMBWTC-YDIMZXDKSA-N |
| XLogP | 5.08 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |