C26H17N3O3S2 — CID 56964997
(2'S,3R,7'S)-2,4'-dioxo-2',7'-dithiophen-2-ylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile (PubChem CID 56964997) has the molecular formula C26H17N3O3S2 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2'S,3R,7'S)-2,4'-dioxo-2',7'-dithiophen-2-ylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile.
| Compound Name | (2'S,3R,7'S)-2,4'-dioxo-2',7'-dithiophen-2-ylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile |
|---|---|
| PubChem CID | 56964997 |
| Molecular Formula | C26H17N3O3S2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | (2'S,3R,7'S)-2,4'-dioxo-2',7'-dithiophen-2-ylspiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile |
| SMILES | N#CC1(C#N)[C@@H](c2cccs2)CC2=C(C(=O)C[C@@H](c3cccs3)O2)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C26H17N3O3S2/c27-13-25(14-28)16(21-7-3-9-33-21)11-20-23(18(30)12-19(32-20)22-8-4-10-34-22)26(25)15-5-1-2-6-17(15)29-24(26)31/h1-10,16,19H,11-12H2,(H,29,31)/t16-,19+,26-/m1/s1 |
| InChIKey | XMJRMQHFFPSLNS-ROGNIZAZSA-N |
| XLogP | 5.21 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |