About CID 7096564
CID 7096564 (PubChem CID 7096564) has the molecular formula C24H21N2O3S+
and a molecular weight of 417.51 g/mol.
Molecular Properties
| Compound Name | CID 7096564 |
| PubChem CID | 7096564 |
| Molecular Formula | C24H21N2O3S+ |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | — |
| SMILES | C[NH+]1C[C@@H](c2cccs2)[C@]2(COc3ccccc3C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H20N2O3S/c1-26-13-17(20-11-6-12-30-20)23(14-29-19-10-5-2-7-15(19)21(23)27)24(26)16-8-3-4-9-18(16)25-22(24)28/h2-12,17H,13-14H2,1H3,(H,25,28)/p+1/t17-,23-,24-/m0/s1 |
| InChIKey | KREXOOXCKFMSFM-DPSWKAHMSA-O |
| XLogP | 2.47 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 7096564 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 7096564?
The IUPAC name of CID 7096564 (CID 7096564) is not available.
What is the SMILES notation for CID 7096564?
The canonical SMILES for CID 7096564 is C[NH+]1C[C@@H](c2cccs2)[C@]2(COc3ccccc3C2=O)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 7096564?
The InChIKey is KREXOOXCKFMSFM-DPSWKAHMSA-O. The full InChI is InChI=1S/C24H20N2O3S/c1-26-13-17(20-11-6-12-30-20)23(14-29-19-10-5-2-7-15(19)21(23)27)24(26)16-8-3-4-9-18(16)25-22(24)28/h2-12,17H,13-14H2,1H3,(H,25,28)/p+1/t17-,23-,24-/m0/s1.
What are the key properties of CID 7096564?
CID 7096564 has a molecular weight of 417.51 g/mol, XLogP of 2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 7096564 is sourced from PubChem (CID 7096564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).