C24H21N2O3S+ — CID 7096564
CID 7096564 (PubChem CID 7096564) has the molecular formula C24H21N2O3S+ and a molecular weight of 417.51 g/mol.
| Compound Name | CID 7096564 |
|---|---|
| PubChem CID | 7096564 |
| Molecular Formula | C24H21N2O3S+ |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | — |
| SMILES | C[NH+]1C[C@@H](c2cccs2)[C@]2(COc3ccccc3C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H20N2O3S/c1-26-13-17(20-11-6-12-30-20)23(14-29-19-10-5-2-7-15(19)21(23)27)24(26)16-8-3-4-9-18(16)25-22(24)28/h2-12,17H,13-14H2,1H3,(H,25,28)/p+1/t17-,23-,24-/m0/s1 |
| InChIKey | KREXOOXCKFMSFM-DPSWKAHMSA-O |
| XLogP | 2.47 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |