C23H18O3S — CID 139260743
(3'S,5'S)-3'-phenyl-5'-thiophen-2-ylspiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione (PubChem CID 139260743) has the molecular formula C23H18O3S and a molecular weight of 374.46 g/mol. Its IUPAC name is (3'S,5'S)-3'-phenyl-5'-thiophen-2-ylspiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione.
| Compound Name | (3'S,5'S)-3'-phenyl-5'-thiophen-2-ylspiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione |
|---|---|
| PubChem CID | 139260743 |
| Molecular Formula | C23H18O3S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3'S,5'S)-3'-phenyl-5'-thiophen-2-ylspiro[1-benzofuran-3,4'-cyclohexane]-1',2-dione |
| SMILES | O=C1C[C@H](c2cccs2)C2(C(=O)Oc3ccccc32)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H18O3S/c24-16-13-18(15-7-2-1-3-8-15)23(19(14-16)21-11-6-12-27-21)17-9-4-5-10-20(17)26-22(23)25/h1-12,18-19H,13-14H2/t18-,19+,23?/m0/s1 |
| InChIKey | ZVDMJUYIKIXVIF-HXIJRHRVSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|