C20H16O3 — CID 102433691
(3S,5'R)-3'-methyl-5'-phenylspiro[1-benzofuran-3,4'-cyclohex-2-ene]-1',2-dione (PubChem CID 102433691) has the molecular formula C20H16O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3S,5'R)-3'-methyl-5'-phenylspiro[1-benzofuran-3,4'-cyclohex-2-ene]-1',2-dione.
| Compound Name | (3S,5'R)-3'-methyl-5'-phenylspiro[1-benzofuran-3,4'-cyclohex-2-ene]-1',2-dione |
|---|---|
| PubChem CID | 102433691 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3S,5'R)-3'-methyl-5'-phenylspiro[1-benzofuran-3,4'-cyclohex-2-ene]-1',2-dione |
| SMILES | CC1=CC(=O)C[C@H](c2ccccc2)[C@]12C(=O)Oc1ccccc12 |
| InChI | InChI=1S/C20H16O3/c1-13-11-15(21)12-17(14-7-3-2-4-8-14)20(13)16-9-5-6-10-18(16)23-19(20)22/h2-11,17H,12H2,1H3/t17-,20+/m1/s1 |
| InChIKey | MJCIYJHFUNRABV-XLIONFOSSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|