C21H16Cl2O4 — CID 71528555
ethyl (3S,4'S)-4'-(2,4-dichlorophenyl)-2-oxospiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate (PubChem CID 71528555) has the molecular formula C21H16Cl2O4 and a molecular weight of 403.26 g/mol. Its IUPAC name is ethyl (3S,4'S)-4'-(2,4-dichlorophenyl)-2-oxospiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate.
| Compound Name | ethyl (3S,4'S)-4'-(2,4-dichlorophenyl)-2-oxospiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate |
|---|---|
| PubChem CID | 71528555 |
| Molecular Formula | C21H16Cl2O4 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | ethyl (3S,4'S)-4'-(2,4-dichlorophenyl)-2-oxospiro[1-benzofuran-3,5'-cyclopentene]-1'-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@H](c2ccc(Cl)cc2Cl)[C@@]12C(=O)Oc1ccccc12 |
| InChI | InChI=1S/C21H16Cl2O4/c1-2-26-19(24)16-10-9-14(13-8-7-12(22)11-17(13)23)21(16)15-5-3-4-6-18(15)27-20(21)25/h3-8,10-11,14H,2,9H2,1H3/t14-,21+/m1/s1 |
| InChIKey | KGQFNFHYPXRTDK-SZNDQCEHSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|