C17H18Cl2O5 — CID 1254596
ethyl (3R,6R)-6-(2,4-dichlorophenyl)-3,5,5-trimethyl-2,4-dioxooxane-3-carboxylate (PubChem CID 1254596) has the molecular formula C17H18Cl2O5 and a molecular weight of 373.23 g/mol. Its IUPAC name is ethyl (3R,6R)-6-(2,4-dichlorophenyl)-3,5,5-trimethyl-2,4-dioxooxane-3-carboxylate.
| Compound Name | ethyl (3R,6R)-6-(2,4-dichlorophenyl)-3,5,5-trimethyl-2,4-dioxooxane-3-carboxylate |
|---|---|
| PubChem CID | 1254596 |
| Molecular Formula | C17H18Cl2O5 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | ethyl (3R,6R)-6-(2,4-dichlorophenyl)-3,5,5-trimethyl-2,4-dioxooxane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C(=O)O[C@@H](c2ccc(Cl)cc2Cl)C(C)(C)C1=O |
| InChI | InChI=1S/C17H18Cl2O5/c1-5-23-14(21)17(4)13(20)16(2,3)12(24-15(17)22)10-7-6-9(18)8-11(10)19/h6-8,12H,5H2,1-4H3/t12-,17+/m0/s1 |
| InChIKey | ONBUKAOVHOTYIP-YVEFUNNKSA-N |
| XLogP | 3.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|